pomoc oko matematickog zadatka
Strana 1 od 2 12 PoslednjaPoslednja
Prikazujem rezultate 1 do 25 od 28

Tema: pomoc oko matematickog zadatka

  1. #1
    Početnik
    Učlanjen
    11.01.2007.
    Pol
    muški
    Poruke
    29
    Reputaciona moć
    0

    Podrazumevano pomoc oko matematickog zadatka

    cos7+cos79+cos151+cos223+cos295=
    ceo dan pokusavam da resim ovo pa ako neko zna da mi pomogne unapred hvala



  2. #2
    Domaćin koca chemist (avatar)
    Učlanjen
    21.09.2008.
    Pol
    muški
    Lokacija
    U stanu....
    Poruke
    3.171
    Reputaciona moć
    65

    Podrazumevano Re: pomoc oko matematickog zadatka

    Citat Original postavio Kostach Pogledaj poruku
    cos7+cos79+cos151+cos223+cos295=
    ceo dan pokusavam da resim ovo pa ako neko zna da mi pomogne unapred hvala
    Probaj da svedes sve na ovu sedmicu!
    Skromnost se daruje veličinama.
    Kako je teško biti skroman,
    kad si nitko i ništa.

  3. #3
    Početnik
    Učlanjen
    11.01.2007.
    Pol
    muški
    Poruke
    29
    Reputaciona moć
    0

    Podrazumevano Re: pomoc oko matematickog zadatka

    ma pokusao sam nikako nece

  4. #4
    Domaćin koca chemist (avatar)
    Učlanjen
    21.09.2008.
    Pol
    muški
    Lokacija
    U stanu....
    Poruke
    3.171
    Reputaciona moć
    65

    Podrazumevano Re: pomoc oko matematickog zadatka

    Evo ja sam dobio neki budjav iraz sve preko sedmice samo da vidim dokle mogu da teram....
    Skromnost se daruje veličinama.
    Kako je teško biti skroman,
    kad si nitko i ništa.

  5. #5
    Početnik
    Učlanjen
    11.01.2007.
    Pol
    muški
    Poruke
    29
    Reputaciona moć
    0

    Podrazumevano Re: pomoc oko matematickog zadatka

    ako se racuna preko digitrona ispadne 0 ali ja nikako postupno ne mogu da dodjem

  6. #6
    Domaćin koca chemist (avatar)
    Učlanjen
    21.09.2008.
    Pol
    muški
    Lokacija
    U stanu....
    Poruke
    3.171
    Reputaciona moć
    65

    Podrazumevano Re: pomoc oko matematickog zadatka

    Citat Original postavio Kostach Pogledaj poruku
    ako se racuna preko digitrona ispadne 0 ali ja nikako postupno ne mogu da dodjem
    Evo sacekaj momenat imam nesto samo da nadjem caku za sredjivanje
    Skromnost se daruje veličinama.
    Kako je teško biti skroman,
    kad si nitko i ništa.

  7. #7
    Domaćin koca chemist (avatar)
    Učlanjen
    21.09.2008.
    Pol
    muški
    Lokacija
    U stanu....
    Poruke
    3.171
    Reputaciona moć
    65

    Podrazumevano Re: pomoc oko matematickog zadatka

    Evo ja cu da prikazem do kog dela sam ja stigao i od kog ni makac
    Tj vidim nesto ali ne mogu da skupim hrabrost da napisem
    Evo:
    Dakle kosinuse sam redom prikazao kao
    1.cos7
    2.cos(72+7)
    3.cos(180-36+7)
    4.cos(180+36+7)
    5.cos(360-72+7)

    I sad posle oslobadnja zbira glova dobio sam izraz:
    cos7+2cos72cos7+2sin36sin7;koristeci formulu cos(a+b)=cosacosb-sinasinb i formulu cos(a-b)=cosacosb+sinasinb; dalje sam se oslobodio ugla od 72 i radio ga kao ,,dvostruki,, ,sto mi je mozda bila greska, koristeci formulu cos2a=cos2a-sin2a i dobio:
    cos7+2(cos236-sin236)*cos7-2cos36cos7
    Dalje sam odmah ove ,,kvadratne,, sinuse pretvorio u ,,kvadratne,, kosinuse koristeci osnovni trigonometrijski indetitet i dobio sledecu corbu:
    =-cos7+4cos7cos^2 36-2cos36cos7

    Ako imas vremena pustite me da jos malo porazmislim jer sam podosta siguran da mi je ovaj oblik tacan pa da ga zavrsim....Ili ga ti zavrsi ako umes
    Poslednji put ažurirao/la koca chemist : 10.05.2009. u 00:07
    Skromnost se daruje veličinama.
    Kako je teško biti skroman,
    kad si nitko i ništa.

  8. #8
    Početnik
    Učlanjen
    11.01.2007.
    Pol
    muški
    Poruke
    29
    Reputaciona moć
    0

    Podrazumevano Re: pomoc oko matematickog zadatka

    aj porazmisli
    nekako mi se cini da ne ispada nula ne znam ja ovo da resim

  9. #9
    Početnik
    Učlanjen
    11.01.2007.
    Pol
    muški
    Poruke
    29
    Reputaciona moć
    0

    Podrazumevano Re: pomoc oko matematickog zadatka

    hvala ti puno imam dosta vremena za ponedeljak mi treba aj ako mozes porazmisli jos malo

  10. #10
    Domaćin koca chemist (avatar)
    Učlanjen
    21.09.2008.
    Pol
    muški
    Lokacija
    U stanu....
    Poruke
    3.171
    Reputaciona moć
    65

    Podrazumevano Re: pomoc oko matematickog zadatka

    Jao znam...Kolko sam gloop stoji mi ispred ociju...
    Samo da sklopim ove moje isecke u lepo objasnjenu celinu
    Cek minut....
    Skromnost se daruje veličinama.
    Kako je teško biti skroman,
    kad si nitko i ništa.

  11. #11
    Domaćin koca chemist (avatar)
    Učlanjen
    21.09.2008.
    Pol
    muški
    Lokacija
    U stanu....
    Poruke
    3.171
    Reputaciona moć
    65

    Podrazumevano Re: pomoc oko matematickog zadatka

    Ah ne ovoga sam se plasio....Blockirao saaaaaaaaaaaaaam
    Nasao sam jedno cos od nula koje bi mi resiolo problem a sad ga vise ne vidim
    Jao Boze dragi.....
    Skromnost se daruje veličinama.
    Kako je teško biti skroman,
    kad si nitko i ništa.

  12. #12
    Domaćin koca chemist (avatar)
    Učlanjen
    21.09.2008.
    Pol
    muški
    Lokacija
    U stanu....
    Poruke
    3.171
    Reputaciona moć
    65

    Podrazumevano Re: pomoc oko matematickog zadatka

    Ovaj cos36 je neki mnogo ,,magican,, broj mnogo je nesto specijalan.....
    Da da da da...Dosao sam do oblika 4cos^2 36-2cos36=1
    I dalje ne znam...Umirem ovde...gotovo
    Poslednji put ažurirao/la koca chemist : 09.05.2009. u 23:24
    Skromnost se daruje veličinama.
    Kako je teško biti skroman,
    kad si nitko i ništa.

  13. #13
    Početnik
    Učlanjen
    11.01.2007.
    Pol
    muški
    Poruke
    29
    Reputaciona moć
    0

    Podrazumevano Re: pomoc oko matematickog zadatka

    znaci ne mozes?

  14. #14
    Domaćin koca chemist (avatar)
    Učlanjen
    21.09.2008.
    Pol
    muški
    Lokacija
    U stanu....
    Poruke
    3.171
    Reputaciona moć
    65

    Podrazumevano Re: pomoc oko matematickog zadatka

    Citat Original postavio Kostach Pogledaj poruku
    znaci ne mozes?
    Jel verujes da ga evo i sad radim....
    Skromnost se daruje veličinama.
    Kako je teško biti skroman,
    kad si nitko i ništa.

  15. #15
    Početnik
    Učlanjen
    11.01.2007.
    Pol
    muški
    Poruke
    29
    Reputaciona moć
    0

    Podrazumevano Re: pomoc oko matematickog zadatka

    imas li msn da tamo prodiskutujemo?? aj ostavicu ovde s.kostic92@hotmail.com pa ako imas add me

  16. #16
    Elita Papa Smurf (avatar)
    Učlanjen
    13.04.2009.
    Pol
    muški
    Poruke
    17.315
    Tekstova u blogu
    55
    Reputaciona moć
    6991

    Podrazumevano Re: pomoc oko matematickog zadatka

    cos7 + cos79 + cos151 + cos223 + cos295

    Radimo sve postupno zbog preglednosti:

    cos79 = cos(72+7) = cos72*cos7 - sin72*sin7 =
    = cos7*cos72 - 2*sin36*cos36*sin7

    cos151 = cos(180 - 36 + 7) = - cos(-36 + 7) =
    = -(cos(-36)*cos7 - sin(-36)*sin7) = -cos7*cos36 - sin36*sin7

    cos223 = cos(180 + 36 + 7) = - cos(36 + 7) =
    = -(cos36*cos7 - sin36*sin7) = -cos7*cos36 + sin36*sin7

    cos295 = cos(-72 + 7) = cos(-72)*cos7 - sin(-72)*sin7 =
    = cos72*cos7 + sin72*sin7 =
    = cos7*cos72 + 2*sin36*cos36*sin7

    Sada sve saberemo i dobijamo:

    cos7 + cos7*cos72 - 2*sin36*cos36*sin7 - cos7*cos36 - sin36*sin7 - cos7*cos36 +sin36*sin7 + cos7*cos72 + 2*sin36*cos36*sin7 =

    = cos7 + 2*cos7*cos72 - 2*cos7*cos36 =

    = cos7 * (1 + 2*cos72 - 2*cos36) =

    = cos7 * (1 + 2*(2*cos236 - 1) - 2*cos36) =

    = cos7 * (4*cos236 - 2*cos36 - 1) =

    = cos7 * (cos36 - (1+50.5)/4) * (cos36 - (1-50.5)/4) = 0

    Zato sto je druga zagrada jednaka nuli...

    Nije tesko dokazati da je cos36 = cos(pi/5) = (1+50.5)/4)
    Zavist valja i zaslužiti...

  17. #17
    Domaćin koca chemist (avatar)
    Učlanjen
    21.09.2008.
    Pol
    muški
    Lokacija
    U stanu....
    Poruke
    3.171
    Reputaciona moć
    65

    Podrazumevano Re: pomoc oko matematickog zadatka

    Citat Original postavio jnikola78 Pogledaj poruku
    cos7 + cos79 + cos151 + cos223 + cos295

    Radimo sve postupno zbog preglednosti:

    cos79 = cos(72+7) = cos72*cos7 - sin72*sin7 =
    = cos7*cos72 - 2*sin36*cos36*sin7

    cos151 = cos(180 - 36 + 7) = - cos(-36 + 7) =
    = -(cos(-36)*cos7 - sin(-36)*sin7) = -cos7*cos36 - sin36*sin7

    cos223 = cos(180 + 36 + 7) = - cos(36 + 7) =
    = -(cos36*cos7 - sin36*sin7) = -cos7*cos36 + sin36*sin7

    cos295 = cos(-72 + 7) = cos(-72)*cos7 - sin(-72)*sin7 =
    = cos72*cos7 + sin72*sin7 =
    = cos7*cos72 + 2*sin36*cos36*sin7

    Sada sve saberemo i dobijamo:

    cos7 + cos7*cos72 - 2*sin36*cos36*sin7 - cos7*cos36 - sin36*sin7 - cos7*cos36 +sin36*sin7 + cos7*cos72 + 2*sin36*cos36*sin7 =

    = cos7 + 2*cos7*cos72 - 2*cos7*cos36 =

    = cos7 * (1 + 2*cos72 - 2*cos36) =

    = cos7 * (1 + 2*(2*cos236 - 1) - 2*cos36) =

    = cos7 * (4*cos236 - 2*cos36 - 1) =

    = cos7 * (cos36 - (1+50.5)/4) * (cos36 + (1-50.5)/4) = 0

    Zato sto je druga zagrada jednaka nuli...

    Nije tesko dokazati da je cos36 = cos(pi/5) = (1+50.5)/4)


    Izvoli dokazi!
    Skromnost se daruje veličinama.
    Kako je teško biti skroman,
    kad si nitko i ništa.

  18. #18
    Domaćin koca chemist (avatar)
    Učlanjen
    21.09.2008.
    Pol
    muški
    Lokacija
    U stanu....
    Poruke
    3.171
    Reputaciona moć
    65

    Podrazumevano Re: pomoc oko matematickog zadatka

    Citat Original postavio jnikola78 Pogledaj poruku
    cos7 + cos79 + cos151 + cos223 + cos295

    Radimo sve postupno zbog preglednosti:

    cos79 = cos(72+7) = cos72*cos7 - sin72*sin7 =
    = cos7*cos72 - 2*sin36*cos36*sin7

    cos151 = cos(180 - 36 + 7) = - cos(-36 + 7) =
    = -(cos(-36)*cos7 - sin(-36)*sin7) = -cos7*cos36 - sin36*sin7

    cos223 = cos(180 + 36 + 7) = - cos(36 + 7) =
    = -(cos36*cos7 - sin36*sin7) = -cos7*cos36 + sin36*sin7

    cos295 = cos(-72 + 7) = cos(-72)*cos7 - sin(-72)*sin7 =
    = cos72*cos7 + sin72*sin7 =
    = cos7*cos72 + 2*sin36*cos36*sin7

    Sada sve saberemo i dobijamo:

    cos7 + cos7*cos72 - 2*sin36*cos36*sin7 - cos7*cos36 - sin36*sin7 - cos7*cos36 +sin36*sin7 + cos7*cos72 + 2*sin36*cos36*sin7 =

    = cos7 + 2*cos7*cos72 - 2*cos7*cos36 =

    = cos7 * (1 + 2*cos72 - 2*cos36) =

    = cos7 * (1 + 2*(2*cos236 - 1) - 2*cos36) =

    = cos7 * (4*cos236 - 2*cos36 - 1) =

    = cos7 * (cos36 - (1+50.5)/4) * (cos36 - (1-50.5)/4) = 0

    Zato sto je druga zagrada jednaka nuli...

    Nije tesko dokazati da je cos36 = cos(pi/5) = (1+50.5)/4)
    Sve ovo smo uvideli radice preko msn-a ja i Stefan ali nismo znali kako da dokazemo da je cos36=(1+sqrt5)/4
    Skromnost se daruje veličinama.
    Kako je teško biti skroman,
    kad si nitko i ništa.

  19. #19
    Elita Papa Smurf (avatar)
    Učlanjen
    13.04.2009.
    Pol
    muški
    Poruke
    17.315
    Tekstova u blogu
    55
    Reputaciona moć
    6991

    Podrazumevano Re: pomoc oko matematickog zadatka

    Daj mi par minuta da prekucam...
    Zavist valja i zaslužiti...

  20. #20
    Elita Papa Smurf (avatar)
    Učlanjen
    13.04.2009.
    Pol
    muški
    Poruke
    17.315
    Tekstova u blogu
    55
    Reputaciona moć
    6991

    Podrazumevano Re: pomoc oko matematickog zadatka

    cos36 - cos72 = 2 * sin(72+36)/2 * sin(72-36)/2 = 2 * sin54 * sin18 = 2 * cos36 * cos72

    cos36 - (2*cos236 - 1) = 2 * cos36 * (2*cos236 - 1)

    cos36 - 2*cos236 + 1 = 4*cos236 - 2*cos36

    4*cos336 + 2*cos236 - 3*cos36 - 1 = 0

    Smenom, samo zbog preglednosti, dobijamo: cos36=x

    4*x3 + 2*x2 - 3*x - 1 = 0

    Resenja su:

    x = -1

    x = (1-50.5)/4

    x = (1+50.5)/4

    S obzirom da je cos36 pozitivan broj, uzimamo ovo trece resenje...

    cos36 = (1+50.5)/4
    Zavist valja i zaslužiti...

  21. #21
    Domaćin koca chemist (avatar)
    Učlanjen
    21.09.2008.
    Pol
    muški
    Lokacija
    U stanu....
    Poruke
    3.171
    Reputaciona moć
    65

    Podrazumevano Re: pomoc oko matematickog zadatka

    A sta da je bio negativan cos?


    Ok kapiram....
    Skromnost se daruje veličinama.
    Kako je teško biti skroman,
    kad si nitko i ništa.

  22. #22
    Elita Papa Smurf (avatar)
    Učlanjen
    13.04.2009.
    Pol
    muški
    Poruke
    17.315
    Tekstova u blogu
    55
    Reputaciona moć
    6991

    Podrazumevano Re: pomoc oko matematickog zadatka

    Ako je problem i resavanje jednacine treceg stepena, evo i to:

    4*x3 + 2*x2 - 3*x - 1 =
    = 4*x3 -3*x - x + x + 2*x2 - 1 - 1 + 1 =
    = 4*x3 - 4*x +2*x2 - 2 + (x + 1) =
    = 4*x * (x2 - 1) + 2 * (x2 - 1) + (x + 1) =
    = (x2 - 1) * (4*x + 2) + (x + 1) =
    = (x + 1) * (x - 1) * (4*x + 2) + (x + 1) =
    = (x + 1) * ( (x - 1)*((4*x + 2) + 1) =
    = (x + 1) * (4*x2 - 2*x - 1) =

    Odave sledi da je prvo resenje x = -1, a druga dva se dobijaju resavajuci ovu kvadratnu jednacinu...
    Zavist valja i zaslužiti...

  23. #23
    Domaćin koca chemist (avatar)
    Učlanjen
    21.09.2008.
    Pol
    muški
    Lokacija
    U stanu....
    Poruke
    3.171
    Reputaciona moć
    65

    Podrazumevano Re: pomoc oko matematickog zadatka

    Citat Original postavio jnikola78 Pogledaj poruku
    Ako je problem i resavanje jednacine treceg stepena, evo i to:

    4*x3 + 2*x2 - 3*x - 1 =
    = 4*x3 -3*x - x + x + 2*x2 - 1 - 1 + 1 =
    = 4*x3 - 4*x +2*x2 - 2 + (x + 1) =
    = 4*x * (x2 - 1) + 2 * (x2 - 1) + (x + 1) =
    = (x2 - 1) * (4*x + 2) + (x + 1) =
    = (x + 1) * (x - 1) * (4*x + 2) + (x + 1) =
    = (x + 1) * ( (x - 1)*((4*x + 2) + 1) =
    = (x + 1) * (4*x2 - 2*x - 1) =

    Odave sledi da je prvo resenje x = -1, a druga dva se dobijaju resavajuci ovu kvadratnu jednacinu...
    Ne nije problem resavanje jednacine bilo kog n-tog stepena zahvaljujuci Paganku koji me je uputio na semu jednu lepu
    Skromnost se daruje veličinama.
    Kako je teško biti skroman,
    kad si nitko i ništa.

  24. #24
    Elita Papa Smurf (avatar)
    Učlanjen
    13.04.2009.
    Pol
    muški
    Poruke
    17.315
    Tekstova u blogu
    55
    Reputaciona moć
    6991

    Podrazumevano Re: pomoc oko matematickog zadatka

    Citat Original postavio koca chemist Pogledaj poruku
    A sta da je bio negativan cos?


    Ok kapiram....
    Ne razumem pitanje... Iz trigonometrijskog kruga je sasvim jasno za bilo koju trigonometrijsku funkciju kada je pozitivna a kada negativna... Da smo imali cos ugla kao negativnu vrednost, izabrali bi negativno resenje... Pri cemu, naravno, -1 otpada jer je to cos180...
    Zavist valja i zaslužiti...

  25. #25
    Početnik
    Učlanjen
    11.01.2007.
    Pol
    muški
    Poruke
    29
    Reputaciona moć
    0

    Podrazumevano Re: pomoc oko matematickog zadatka

    hvala puno

Slične teme

  1. Da li neko zna ... (pomoc oko zadatka)
    Autor coeur u forumu Prirodne nauke
    Odgovora: 2
    Poslednja poruka: 11.06.2007., 22:05
  2. C Potrebna pomoc oko 3 zadatka (ispit)
    Autor vlada84 u forumu Programiranje
    Odgovora: 28
    Poslednja poruka: 22.09.2006., 22:31
  3. Pomoc oko zadatka.Hitno
    Autor traper13 u forumu Prirodne nauke
    Odgovora: 14
    Poslednja poruka: 23.06.2006., 15:32
  4. Pomoc oko zadatka iz stereometrije
    Autor MT/31 u forumu Škole
    Odgovora: 1
    Poslednja poruka: 26.09.2004., 22:22
  5. Pomoc oko zadatka iz stereometrije
    Autor MT/31 u forumu Prirodne nauke
    Odgovora: 1
    Poslednja poruka: 25.09.2004., 02:12

Pravila za slanje poruka

  • Ne možete kreirati novu temu
  • Ne možete poslati odgovor
  • Ne možete dodati priloge
  • Ne možete prepraviti svoju poruku
  •